C8H14O5 — CID 145429784
(5S,6R,7R,8R)-5-methyl-4-oxaspiro[2.5]octane-2,6,7,8-tetrol (PubChem CID 145429784) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (5S,6R,7R,8R)-5-methyl-4-oxaspiro[2.5]octane-2,6,7,8-tetrol.
| Compound Name | (5S,6R,7R,8R)-5-methyl-4-oxaspiro[2.5]octane-2,6,7,8-tetrol |
|---|---|
| PubChem CID | 145429784 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (5S,6R,7R,8R)-5-methyl-4-oxaspiro[2.5]octane-2,6,7,8-tetrol |
| SMILES | C[C@@H]1OC2(CC2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O5/c1-3-5(10)6(11)7(12)8(13-3)2-4(8)9/h3-7,9-12H,2H2,1H3/t3-,4?,5-,6+,7+,8?/m0/s1 |
| InChIKey | YSZKPISCJYHDMV-RJQZSAGSSA-N |
| XLogP | -2.01 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |