C7H12FO8P-2 — CID 102592891
[fluoro-[(2S,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]methyl]-trioxidophosphanium (PubChem CID 102592891) has the molecular formula C7H12FO8P-2 and a molecular weight of 274.14 g/mol. Its IUPAC name is [fluoro-[(2S,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]methyl]-trioxidophosphanium.
| Compound Name | [fluoro-[(2S,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]methyl]-trioxidophosphanium |
|---|---|
| PubChem CID | 102592891 |
| Molecular Formula | C7H12FO8P-2 |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | [fluoro-[(2S,3R,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-methyloxan-2-yl]methyl]-trioxidophosphanium |
| SMILES | C[C@@H]1O[C@](O)(C(F)[P+]([O-])([O-])[O-])[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14FO8P/c1-2-3(9)4(10)5(11)7(12,16-2)6(8)17(13,14)15/h2-6,9-12H,1H3,(H2,13,14,15)/p-2/t2-,3-,4+,5+,6?,7-/m0/s1 |
| InChIKey | MZLJULVMXCJTDR-ZRJWCFDSSA-L |
| XLogP | -4.68 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | -4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|