C7H12F2O6 — CID 170546402
(3R,4S,5R,6R)-2-(difluoromethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 170546402) has the molecular formula C7H12F2O6 and a molecular weight of 230.16 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-(difluoromethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5R,6R)-2-(difluoromethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 170546402 |
| Molecular Formula | C7H12F2O6 |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (3R,4S,5R,6R)-2-(difluoromethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1OC(O)(C(F)F)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H12F2O6/c8-6(9)7(14)5(13)4(12)3(11)2(1-10)15-7/h2-6,10-14H,1H2/t2-,3+,4+,5-,7?/m1/s1 |
| InChIKey | XYDHDSAPJFLWOF-NERHRWIRSA-N |
| XLogP | -2.59 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |