C13H16F2O7 — CID 162539631
(2S,3R,4S,5S,6R)-2-[4-(difluoromethyl)phenoxy]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 162539631) has the molecular formula C13H16F2O7 and a molecular weight of 322.26 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-(difluoromethyl)phenoxy]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-(difluoromethyl)phenoxy]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 162539631 |
| Molecular Formula | C13H16F2O7 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-(difluoromethyl)phenoxy]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@](O)(Oc2ccc(C(F)F)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16F2O7/c14-12(15)6-1-3-7(4-2-6)21-13(20)11(19)10(18)9(17)8(5-16)22-13/h1-4,8-12,16-20H,5H2/t8-,9-,10+,11-,13-/m1/s1 |
| InChIKey | VVUKEKRTKCRHCV-BZNQNGANSA-N |
| XLogP | -0.88 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|