C8H13BrO8 — CID 142714224
[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] 2-bromoacetate (PubChem CID 142714224) has the molecular formula C8H13BrO8 and a molecular weight of 317.09 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] 2-bromoacetate.
| Compound Name | [(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] 2-bromoacetate |
|---|---|
| PubChem CID | 142714224 |
| Molecular Formula | C8H13BrO8 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | [(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] 2-bromoacetate |
| SMILES | O=C(CBr)OC1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H13BrO8/c9-1-4(11)17-8(15)7(14)6(13)5(12)3(2-10)16-8/h3,5-7,10,12-15H,1-2H2/t3-,5-,6+,7-,8?/m1/s1 |
| InChIKey | BUGKZPZBDUVFHR-IANFNVNHSA-N |
| XLogP | -2.96 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|