C6H13O10P — CID 141311551
[(3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate (PubChem CID 141311551) has the molecular formula C6H13O10P and a molecular weight of 276.13 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate.
| Compound Name | [(3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 141311551 |
| Molecular Formula | C6H13O10P |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | [(3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1(O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13O10P/c7-1-2-3(8)4(9)5(10)6(11,15-2)16-17(12,13)14/h2-5,7-11H,1H2,(H2,12,13,14)/t2-,3+,4+,5-,6?/m1/s1 |
| InChIKey | SMYFATMHVQSESC-SVZMEOIVSA-N |
| XLogP | -3.78 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|