C14H22O16 — CID 174160033
bis[(2S,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] oxalate (PubChem CID 174160033) has the molecular formula C14H22O16 and a molecular weight of 446.31 g/mol. Its IUPAC name is bis[(2S,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] oxalate.
| Compound Name | bis[(2S,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] oxalate |
|---|---|
| PubChem CID | 174160033 |
| Molecular Formula | C14H22O16 |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | bis[(2S,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] oxalate |
| SMILES | O=C(O[C@@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)C(=O)O[C@@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H22O16/c15-1-3-5(17)7(19)9(21)13(25,27-3)29-11(23)12(24)30-14(26)10(22)8(20)6(18)4(2-16)28-14/h3-10,15-22,25-26H,1-2H2/t3-,4-,5-,6-,7+,8+,9+,10+,13+,14+/m1/s1 |
| InChIKey | QYTFUUVSGUAOSG-MWMBEVJHSA-N |
| XLogP | -7.69 |
| TPSA | 273.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | -7.69 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|