C15H28O8 — CID 140550027
[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] 2-methyloctanoate (PubChem CID 140550027) has the molecular formula C15H28O8 and a molecular weight of 336.38 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] 2-methyloctanoate.
| Compound Name | [(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] 2-methyloctanoate |
|---|---|
| PubChem CID | 140550027 |
| Molecular Formula | C15H28O8 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] 2-methyloctanoate |
| SMILES | CCCCCCC(C)C(=O)OC1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H28O8/c1-3-4-5-6-7-9(2)14(20)23-15(21)13(19)12(18)11(17)10(8-16)22-15/h9-13,16-19,21H,3-8H2,1-2H3/t9?,10-,11-,12+,13-,15?/m1/s1 |
| InChIKey | HHDCZMUOBGMZNF-RTYJGELYSA-N |
| XLogP | -0.74 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|