C6H11BrO6 — CID 141299257
(2S,3R,4S,5S,6R)-2-bromo-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 141299257) has the molecular formula C6H11BrO6 and a molecular weight of 259.05 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-bromo-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-2-bromo-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 141299257 |
| Molecular Formula | C6H11BrO6 |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-bromo-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@](O)(Br)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11BrO6/c7-6(12)5(11)4(10)3(9)2(1-8)13-6/h2-5,8-12H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | CZRSKFYUJKUZNU-DVKNGEFBSA-N |
| XLogP | -2.50 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|