C9H19O8P — CID 102592889
(2S,3R,4R,5R,6S)-2-(dimethoxyphosphorylmethyl)-6-methyloxane-2,3,4,5-tetrol (PubChem CID 102592889) has the molecular formula C9H19O8P and a molecular weight of 286.22 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-(dimethoxyphosphorylmethyl)-6-methyloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4R,5R,6S)-2-(dimethoxyphosphorylmethyl)-6-methyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 102592889 |
| Molecular Formula | C9H19O8P |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-(dimethoxyphosphorylmethyl)-6-methyloxane-2,3,4,5-tetrol |
| SMILES | COP(=O)(C[C@@]1(O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O)OC |
| InChI | InChI=1S/C9H19O8P/c1-5-6(10)7(11)8(12)9(13,17-5)4-18(14,15-2)16-3/h5-8,10-13H,4H2,1-3H3/t5-,6-,7+,8+,9+/m0/s1 |
| InChIKey | ZLCKTNLZYYQUHU-OFPUPOEVSA-N |
| XLogP | -1.34 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|