C13H27NO5 — CID 70126366
(2S,3S,4R,5S,6S)-2-(2-aminoheptyl)-6-methyloxane-2,3,4,5-tetrol (PubChem CID 70126366) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-2-(2-aminoheptyl)-6-methyloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4R,5S,6S)-2-(2-aminoheptyl)-6-methyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 70126366 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-(2-aminoheptyl)-6-methyloxane-2,3,4,5-tetrol |
| SMILES | CCCCCC(N)C[C@]1(O)O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H27NO5/c1-3-4-5-6-9(14)7-13(18)12(17)11(16)10(15)8(2)19-13/h8-12,15-18H,3-7,14H2,1-2H3/t8-,9?,10+,11+,12-,13-/m0/s1 |
| InChIKey | UMUXGXIWRWHIKI-AHRZCNIPSA-N |
| XLogP | -0.53 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|