C16H32O6 — CID 57025902
(2R,3R,4S,5S)-2-decyl-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-triol (PubChem CID 57025902) has the molecular formula C16H32O6 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-decyl-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-triol.
| Compound Name | (2R,3R,4S,5S)-2-decyl-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 57025902 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (2R,3R,4S,5S)-2-decyl-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-triol |
| SMILES | CCCCCCCCCC[C@@]1(O)O[C@@H]([C@H](O)CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H32O6/c1-2-3-4-5-6-7-8-9-10-16(21)15(20)13(19)14(22-16)12(18)11-17/h12-15,17-21H,2-11H2,1H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | IMNCEHTZIOXSBX-IBEHDNSVSA-N |
| XLogP | 0.68 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|