About 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol
2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol (PubChem CID 559119) has the molecular formula C16H32O5S
and a molecular weight of 336.49 g/mol. Its IUPAC name is 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol.
Molecular Properties
| Compound Name | 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol |
| PubChem CID | 559119 |
| Molecular Formula | C16H32O5S |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol |
| SMILES | CCCCCCCCCCSC1OC(C(O)CO)C(O)C1O |
| InChI | InChI=1S/C16H32O5S/c1-2-3-4-5-6-7-8-9-10-22-16-14(20)13(19)15(21-16)12(18)11-17/h12-20H,2-11H2,1H3 |
| InChIKey | YXNPOIOHXSYBBW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol?
The IUPAC name of 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol (CID 559119) is 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol.
What is the SMILES notation for 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol?
The canonical SMILES for 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol is CCCCCCCCCCSC1OC(C(O)CO)C(O)C1O.
What is the InChIKey of 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol?
The InChIKey is YXNPOIOHXSYBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O5S/c1-2-3-4-5-6-7-8-9-10-22-16-14(20)13(19)15(21-16)12(18)11-17/h12-20H,2-11H2,1H3.
What are the key properties of 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol?
2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol has a molecular weight of 336.49 g/mol, XLogP of 1.66, 12 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decylsulfanyl-5-(1,2-dihydroxyethyl)oxolane-3,4-diol is sourced from PubChem (CID 559119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).