C12H22O7 — CID 54261459
(2S)-2-[(2R,3R,4R,5S)-5-hexyl-3,4,5-trihydroxyoxolan-2-yl]-2-hydroxyacetic acid (PubChem CID 54261459) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is (2S)-2-[(2R,3R,4R,5S)-5-hexyl-3,4,5-trihydroxyoxolan-2-yl]-2-hydroxyacetic acid.
| Compound Name | (2S)-2-[(2R,3R,4R,5S)-5-hexyl-3,4,5-trihydroxyoxolan-2-yl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 54261459 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2S)-2-[(2R,3R,4R,5S)-5-hexyl-3,4,5-trihydroxyoxolan-2-yl]-2-hydroxyacetic acid |
| SMILES | CCCCCC[C@]1(O)O[C@@H]([C@H](O)C(=O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O7/c1-2-3-4-5-6-12(18)10(15)7(13)9(19-12)8(14)11(16)17/h7-10,13-15,18H,2-6H2,1H3,(H,16,17)/t7-,8-,9+,10+,12-/m0/s1 |
| InChIKey | RDUNCMMTRROTND-YOQJGNTNSA-N |
| XLogP | -0.79 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|