C12H22O7 — CID 173254055
(3S,4R,5S)-5-[(1S)-1,2-dihydroxyoct-2-enyl]oxolane-2,2,3,4-tetrol (PubChem CID 173254055) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3S,4R,5S)-5-[(1S)-1,2-dihydroxyoct-2-enyl]oxolane-2,2,3,4-tetrol.
| Compound Name | (3S,4R,5S)-5-[(1S)-1,2-dihydroxyoct-2-enyl]oxolane-2,2,3,4-tetrol |
|---|---|
| PubChem CID | 173254055 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (3S,4R,5S)-5-[(1S)-1,2-dihydroxyoct-2-enyl]oxolane-2,2,3,4-tetrol |
| SMILES | CCCCCC=C(O)[C@@H](O)[C@H]1OC(O)(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O7/c1-2-3-4-5-6-7(13)8(14)10-9(15)11(16)12(17,18)19-10/h6,8-11,13-18H,2-5H2,1H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | HHZLSSFXXIJXSH-YTWAJWBKSA-N |
| XLogP | -0.87 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|