C15H28O8 — CID 169102235
[(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] nonanoate (PubChem CID 169102235) has the molecular formula C15H28O8 and a molecular weight of 336.38 g/mol. Its IUPAC name is [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] nonanoate.
| Compound Name | [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] nonanoate |
|---|---|
| PubChem CID | 169102235 |
| Molecular Formula | C15H28O8 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC1O[C@@](O)(CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H28O8/c1-2-3-4-5-6-7-8-10(17)22-14-12(19)11(18)13(20)15(21,9-16)23-14/h11-14,16,18-21H,2-9H2,1H3/t11-,12+,13+,14?,15+/m1/s1 |
| InChIKey | WVBBJBNSZMKPJN-FJOZMYMESA-N |
| XLogP | -0.60 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|