C11H21BrO6 — CID 175181956
(3R,4R,5R,6S)-6-bromo-6-(hydroxymethyl)-2-pentyloxane-2,3,4,5-tetrol (PubChem CID 175181956) has the molecular formula C11H21BrO6 and a molecular weight of 329.19 g/mol. Its IUPAC name is (3R,4R,5R,6S)-6-bromo-6-(hydroxymethyl)-2-pentyloxane-2,3,4,5-tetrol.
| Compound Name | (3R,4R,5R,6S)-6-bromo-6-(hydroxymethyl)-2-pentyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 175181956 |
| Molecular Formula | C11H21BrO6 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (3R,4R,5R,6S)-6-bromo-6-(hydroxymethyl)-2-pentyloxane-2,3,4,5-tetrol |
| SMILES | CCCCCC1(O)O[C@](Br)(CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21BrO6/c1-2-3-4-5-11(17)9(16)7(14)8(15)10(12,6-13)18-11/h7-9,13-17H,2-6H2,1H3/t7-,8+,9+,10+,11?/m0/s1 |
| InChIKey | NUXMFJJEESDXTB-VUQZHNRUSA-N |
| XLogP | -0.55 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|