C13H25NO6 — CID 150363808
N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)-2-pentyloxan-3-yl]acetamide (PubChem CID 150363808) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)-2-pentyloxan-3-yl]acetamide.
| Compound Name | N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)-2-pentyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 150363808 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)-2-pentyloxan-3-yl]acetamide |
| SMILES | CCCCCC1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C13H25NO6/c1-3-4-5-6-13(19)12(14-8(2)16)11(18)10(17)9(7-15)20-13/h9-12,15,17-19H,3-7H2,1-2H3,(H,14,16)/t9-,10-,11+,12-,13?/m1/s1 |
| InChIKey | GWGQAKGRNBKDDJ-HENWMNBSSA-N |
| XLogP | -1.13 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|