C14H29NO5 — CID 151026120
(3R,4R,5S,6R)-3-amino-3-heptyl-6-(hydroxymethyl)-2-methyloxane-2,4,5-triol (PubChem CID 151026120) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-amino-3-heptyl-6-(hydroxymethyl)-2-methyloxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-3-amino-3-heptyl-6-(hydroxymethyl)-2-methyloxane-2,4,5-triol |
|---|---|
| PubChem CID | 151026120 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-3-heptyl-6-(hydroxymethyl)-2-methyloxane-2,4,5-triol |
| SMILES | CCCCCCC[C@@]1(N)[C@@H](O)[C@H](O)[C@@H](CO)OC1(C)O |
| InChI | InChI=1S/C14H29NO5/c1-3-4-5-6-7-8-14(15)12(18)11(17)10(9-16)20-13(14,2)19/h10-12,16-19H,3-9,15H2,1-2H3/t10-,11-,12+,13?,14-/m1/s1 |
| InChIKey | LZBXTNSWNUWJRD-SYCZCVCYSA-N |
| XLogP | -0.13 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|