C9H16O6S — CID 22850435
3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyl-2-sulfanyloxan-2-yl]propanoic acid (PubChem CID 22850435) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyl-2-sulfanyloxan-2-yl]propanoic acid.
| Compound Name | 3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyl-2-sulfanyloxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 22850435 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyl-2-sulfanyloxan-2-yl]propanoic acid |
| SMILES | C[C@@H]1O[C@](S)(CCC(=O)O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O6S/c1-4-6(12)7(13)8(14)9(16,15-4)3-2-5(10)11/h4,6-8,12-14,16H,2-3H2,1H3,(H,10,11)/t4-,6-,7+,8+,9-/m0/s1 |
| InChIKey | JZLVJKGIJKTRAA-CZDFEVGMSA-N |
| XLogP | -1.02 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|