C12H22O7S — CID 68788868
3-[1-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypropylsulfanyl]propanoic acid (PubChem CID 68788868) has the molecular formula C12H22O7S and a molecular weight of 310.37 g/mol. Its IUPAC name is 3-[1-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypropylsulfanyl]propanoic acid.
| Compound Name | 3-[1-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypropylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 68788868 |
| Molecular Formula | C12H22O7S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-[1-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypropylsulfanyl]propanoic acid |
| SMILES | CCC(OC1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O)SCCC(=O)O |
| InChI | InChI=1S/C12H22O7S/c1-3-8(20-5-4-7(13)14)19-12-11(17)10(16)9(15)6(2)18-12/h6,8-12,15-17H,3-5H2,1-2H3,(H,13,14)/t6-,8?,9+,10+,11-,12?/m0/s1 |
| InChIKey | MGPJCJHCZUCENC-XYXVJZMOSA-N |
| XLogP | -0.23 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|