C11H20O7 — CID 90162016
3-[(2R,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypentanoic acid (PubChem CID 90162016) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is 3-[(2R,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypentanoic acid.
| Compound Name | 3-[(2R,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 90162016 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-[(2R,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypentanoic acid |
| SMILES | CCC(CC(=O)O)O[C@@H]1OC(C)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C11H20O7/c1-3-6(4-7(12)13)18-11-10(16)9(15)8(14)5(2)17-11/h5-6,8-11,14-16H,3-4H2,1-2H3,(H,12,13)/t5?,6?,8-,9-,10?,11-/m0/s1 |
| InChIKey | ZIRJEKHLBMYJGY-MMUVCKBWSA-N |
| XLogP | -0.92 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |