C30H56O9 — CID 101420107
3-[3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxydodecanoyloxy]dodecanoic acid (PubChem CID 101420107) has the molecular formula C30H56O9 and a molecular weight of 560.77 g/mol. Its IUPAC name is 3-[3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxydodecanoyloxy]dodecanoic acid.
| Compound Name | 3-[3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxydodecanoyloxy]dodecanoic acid |
|---|---|
| PubChem CID | 101420107 |
| Molecular Formula | C30H56O9 |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | 3-[3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxydodecanoyloxy]dodecanoic acid |
| SMILES | CCCCCCCCCC(CC(=O)O)OC(=O)CC(CCCCCCCCC)O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H56O9/c1-4-6-8-10-12-14-16-18-23(20-25(31)32)38-26(33)21-24(19-17-15-13-11-9-7-5-2)39-30-29(36)28(35)27(34)22(3)37-30/h22-24,27-30,34-36H,4-21H2,1-3H3,(H,31,32)/t22-,23?,24?,27-,28+,29+,30-/m0/s1 |
| InChIKey | OXOZZIQAJFDZGU-WKLDAGSTSA-N |
| XLogP | 5.26 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|