C26H48O9 — CID 155058698
(3R)-3-[(3R)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxydecanoyl]oxydecanoic acid (PubChem CID 155058698) has the molecular formula C26H48O9 and a molecular weight of 504.66 g/mol. Its IUPAC name is (3R)-3-[(3R)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxydecanoyl]oxydecanoic acid.
| Compound Name | (3R)-3-[(3R)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxydecanoyl]oxydecanoic acid |
|---|---|
| PubChem CID | 155058698 |
| Molecular Formula | C26H48O9 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | (3R)-3-[(3R)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxydecanoyl]oxydecanoic acid |
| SMILES | CCCCCCC[C@H](CC(=O)O)OC(=O)C[C@@H](CCCCCCC)OC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C26H48O9/c1-4-6-8-10-12-14-19(16-21(27)28)34-22(29)17-20(15-13-11-9-7-5-2)35-26-25(32)24(31)23(30)18(3)33-26/h18-20,23-26,30-32H,4-17H2,1-3H3,(H,27,28)/t18?,19-,20-,23?,24?,25?,26?/m1/s1 |
| InChIKey | PPMPLIBYTIWXPG-HTLUOKHZSA-N |
| XLogP | 3.70 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|