C29H54O9 — CID 129155809
(3R)-3-[2-[(3R)-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxydecanoyl]oxypropan-2-yl]decanoic acid (PubChem CID 129155809) has the molecular formula C29H54O9 and a molecular weight of 546.74 g/mol. Its IUPAC name is (3R)-3-[2-[(3R)-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxydecanoyl]oxypropan-2-yl]decanoic acid.
| Compound Name | (3R)-3-[2-[(3R)-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxydecanoyl]oxypropan-2-yl]decanoic acid |
|---|---|
| PubChem CID | 129155809 |
| Molecular Formula | C29H54O9 |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | (3R)-3-[2-[(3R)-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxydecanoyl]oxypropan-2-yl]decanoic acid |
| SMILES | CCCCCCC[C@H](CC(=O)OC(C)(C)[C@H](CCCCCCC)CC(=O)O)O[C@H]1O[C@H](C)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C29H54O9/c1-6-8-10-12-14-16-21(18-23(30)31)29(4,5)38-24(32)19-22(17-15-13-11-9-7-2)37-28-27(35)26(34)25(33)20(3)36-28/h20-22,25-28,33-35H,6-19H2,1-5H3,(H,30,31)/t20-,21-,22-,25-,26-,27-,28-/m1/s1 |
| InChIKey | FKGWXBURVDOACV-DPFHVQFFSA-N |
| XLogP | 4.72 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|