C16H30O8 — CID 171608190
3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydecanoic acid (PubChem CID 171608190) has the molecular formula C16H30O8 and a molecular weight of 350.41 g/mol. Its IUPAC name is 3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydecanoic acid.
| Compound Name | 3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydecanoic acid |
|---|---|
| PubChem CID | 171608190 |
| Molecular Formula | C16H30O8 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydecanoic acid |
| SMILES | CCCCCCCC(CC(=O)O)OC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H30O8/c1-2-3-4-5-6-7-10(8-12(18)19)23-16-15(22)14(21)13(20)11(9-17)24-16/h10-11,13-17,20-22H,2-9H2,1H3,(H,18,19)/t10?,11-,13+,14+,15-,16?/m1/s1 |
| InChIKey | HFTPLRNDWPXLHU-VVLIJDPYSA-N |
| XLogP | 0.01 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|