C14H26O8 — CID 163002123
3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctanoic acid (PubChem CID 163002123) has the molecular formula C14H26O8 and a molecular weight of 322.35 g/mol. Its IUPAC name is 3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctanoic acid.
| Compound Name | 3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctanoic acid |
|---|---|
| PubChem CID | 163002123 |
| Molecular Formula | C14H26O8 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctanoic acid |
| SMILES | CCCCCC(CC(=O)O)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C14H26O8/c1-2-3-4-5-8(6-10(16)17)21-14-13(20)12(19)11(18)9(7-15)22-14/h8-9,11-15,18-20H,2-7H2,1H3,(H,16,17) |
| InChIKey | POHJGNOYLZHOEA-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|