C16H28O10 — CID 171608179
3-[3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoyloxy]pentanoic acid (PubChem CID 171608179) has the molecular formula C16H28O10 and a molecular weight of 380.39 g/mol. Its IUPAC name is 3-[3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoyloxy]pentanoic acid.
| Compound Name | 3-[3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoyloxy]pentanoic acid |
|---|---|
| PubChem CID | 171608179 |
| Molecular Formula | C16H28O10 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoyloxy]pentanoic acid |
| SMILES | CCC(CC(=O)O)OC(=O)CC(CC)OC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H28O10/c1-3-8(5-11(18)19)24-12(20)6-9(4-2)25-16-15(23)14(22)13(21)10(7-17)26-16/h8-10,13-17,21-23H,3-7H2,1-2H3,(H,18,19)/t8?,9?,10-,13+,14+,15-,16?/m1/s1 |
| InChIKey | OZRZGWGQLMALND-MTBCISJZSA-N |
| XLogP | -1.23 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |