C14H24O10 — CID 100954146
(3R)-3-[(3R)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoyl]oxybutanoic acid (PubChem CID 100954146) has the molecular formula C14H24O10 and a molecular weight of 352.34 g/mol. Its IUPAC name is (3R)-3-[(3R)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoyl]oxybutanoic acid.
| Compound Name | (3R)-3-[(3R)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 100954146 |
| Molecular Formula | C14H24O10 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (3R)-3-[(3R)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoyl]oxybutanoic acid |
| SMILES | C[C@H](CC(=O)O)OC(=O)C[C@@H](C)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H24O10/c1-6(3-9(16)17)22-10(18)4-7(2)23-14-13(21)12(20)11(19)8(5-15)24-14/h6-8,11-15,19-21H,3-5H2,1-2H3,(H,16,17)/t6-,7-,8-,11-,12+,13-,14?/m1/s1 |
| InChIKey | ODKJDKGRBANTEM-AADOOKLKSA-N |
| XLogP | -2.01 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |