C13H24O9 — CID 175336148
4-propan-2-yloxy-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid (PubChem CID 175336148) has the molecular formula C13H24O9 and a molecular weight of 324.33 g/mol. Its IUPAC name is 4-propan-2-yloxy-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid.
| Compound Name | 4-propan-2-yloxy-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 175336148 |
| Molecular Formula | C13H24O9 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-propan-2-yloxy-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid |
| SMILES | CC(C)OCC(CC(=O)O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O9/c1-6(2)20-5-7(3-9(15)16)21-13-12(19)11(18)10(17)8(4-14)22-13/h6-8,10-14,17-19H,3-5H2,1-2H3,(H,15,16)/t7?,8-,10-,11+,12-,13?/m1/s1 |
| InChIKey | XGRYBUGHQZNTQG-CHPNHDTHSA-N |
| XLogP | -1.93 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |