C15H26O9 — CID 171608192
3-[3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanoyloxy]pentanoic acid (PubChem CID 171608192) has the molecular formula C15H26O9 and a molecular weight of 350.36 g/mol. Its IUPAC name is 3-[3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanoyloxy]pentanoic acid.
| Compound Name | 3-[3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanoyloxy]pentanoic acid |
|---|---|
| PubChem CID | 171608192 |
| Molecular Formula | C15H26O9 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanoyloxy]pentanoic acid |
| SMILES | CCC(CC(=O)O)OC(=O)CC(CC)OC1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H26O9/c1-3-8(5-11(17)18)23-12(19)6-9(4-2)24-15-14(21)13(20)10(16)7-22-15/h8-10,13-16,20-21H,3-7H2,1-2H3,(H,17,18)/t8?,9?,10-,13+,14-,15?/m1/s1 |
| InChIKey | XMEPVSFWMBWHBZ-IUWLVHMHSA-N |
| XLogP | -0.59 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |