C25H46O9 — CID 171608193
3-[3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxydecanoyloxy]decanoic acid (PubChem CID 171608193) has the molecular formula C25H46O9 and a molecular weight of 490.63 g/mol. Its IUPAC name is 3-[3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxydecanoyloxy]decanoic acid.
| Compound Name | 3-[3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxydecanoyloxy]decanoic acid |
|---|---|
| PubChem CID | 171608193 |
| Molecular Formula | C25H46O9 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 3-[3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxydecanoyloxy]decanoic acid |
| SMILES | CCCCCCCC(CC(=O)O)OC(=O)CC(CCCCCCC)OC1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H46O9/c1-3-5-7-9-11-13-18(15-21(27)28)33-22(29)16-19(14-12-10-8-6-4-2)34-25-24(31)23(30)20(26)17-32-25/h18-20,23-26,30-31H,3-17H2,1-2H3,(H,27,28)/t18?,19?,20-,23+,24-,25?/m1/s1 |
| InChIKey | GMXDYFKHLXQOCJ-YFQJKQORSA-N |
| XLogP | 3.31 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|