C25H46O11 — CID 177245718
propan-2-yl 3-[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxydecanoate (PubChem CID 177245718) has the molecular formula C25H46O11 and a molecular weight of 522.63 g/mol. Its IUPAC name is propan-2-yl 3-[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxydecanoate.
| Compound Name | propan-2-yl 3-[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxydecanoate |
|---|---|
| PubChem CID | 177245718 |
| Molecular Formula | C25H46O11 |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | propan-2-yl 3-[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxydecanoate |
| SMILES | CCCCCCCC(CC(=O)OC(C)C)O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O[C@@H]1O[C@H](C)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H46O11/c1-6-7-8-9-10-11-16(12-17(26)32-13(2)3)35-25-23(21(30)19(28)15(5)34-25)36-24-22(31)20(29)18(27)14(4)33-24/h13-16,18-25,27-31H,6-12H2,1-5H3/t14-,15+,16?,18?,19+,20-,21-,22-,23-,24+,25+/m1/s1 |
| InChIKey | ITTHRHSNVHUZJT-BVKSTHJASA-N |
| XLogP | 0.75 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|