C32H60O13 — CID 146578756
3-[(3R)-3-[2,3-dihydroxy-4-methoxy-1-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxypentoxy]decanoyl]oxydecanoic acid (PubChem CID 146578756) has the molecular formula C32H60O13 and a molecular weight of 652.82 g/mol. Its IUPAC name is 3-[(3R)-3-[2,3-dihydroxy-4-methoxy-1-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxypentoxy]decanoyl]oxydecanoic acid.
| Compound Name | 3-[(3R)-3-[2,3-dihydroxy-4-methoxy-1-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxypentoxy]decanoyl]oxydecanoic acid |
|---|---|
| PubChem CID | 146578756 |
| Molecular Formula | C32H60O13 |
| Molecular Weight | 652.82 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | 3-[(3R)-3-[2,3-dihydroxy-4-methoxy-1-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxypentoxy]decanoyl]oxydecanoic acid |
| SMILES | CCCCCCCC(CC(=O)O)OC(=O)C[C@@H](CCCCCCC)OC(OC1OC(C)C(O)C(O)C1O)C(O)C(O)C(C)OC |
| InChI | InChI=1S/C32H60O13/c1-6-8-10-12-14-16-22(18-24(33)34)43-25(35)19-23(17-15-13-11-9-7-2)44-32(29(39)26(36)20(3)41-5)45-31-30(40)28(38)27(37)21(4)42-31/h20-23,26-32,36-40H,6-19H2,1-5H3,(H,33,34)/t20?,21?,22?,23-,26?,27?,28?,29?,30?,31?,32?/m1/s1 |
| InChIKey | DYHBNGODXSJCGA-JMIPEAGXSA-N |
| XLogP | 2.80 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|