C10H21NO5 — CID 157382207
(2S,4S,5R)-2-(1-aminobutan-2-yloxy)-6-methyloxane-3,4,5-triol (PubChem CID 157382207) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is (2S,4S,5R)-2-(1-aminobutan-2-yloxy)-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,4S,5R)-2-(1-aminobutan-2-yloxy)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 157382207 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2S,4S,5R)-2-(1-aminobutan-2-yloxy)-6-methyloxane-3,4,5-triol |
| SMILES | CCC(CN)O[C@H]1OC(C)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C10H21NO5/c1-3-6(4-11)16-10-9(14)8(13)7(12)5(2)15-10/h5-10,12-14H,3-4,11H2,1-2H3/t5?,6?,7-,8-,9?,10+/m0/s1 |
| InChIKey | ULYBDWRPNMZGHK-XBWNETJSSA-N |
| XLogP | -1.43 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |