C10H18O5 — CID 153198364
(2S,4R,5R)-6-[(4R)-1,3-dioxolan-4-yl]-2,4-dimethyloxane-2,5-diol (PubChem CID 153198364) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2S,4R,5R)-6-[(4R)-1,3-dioxolan-4-yl]-2,4-dimethyloxane-2,5-diol.
| Compound Name | (2S,4R,5R)-6-[(4R)-1,3-dioxolan-4-yl]-2,4-dimethyloxane-2,5-diol |
|---|---|
| PubChem CID | 153198364 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (2S,4R,5R)-6-[(4R)-1,3-dioxolan-4-yl]-2,4-dimethyloxane-2,5-diol |
| SMILES | C[C@@H]1C[C@@](C)(O)OC([C@H]2COCO2)[C@@H]1O |
| InChI | InChI=1S/C10H18O5/c1-6-3-10(2,12)15-9(8(6)11)7-4-13-5-14-7/h6-9,11-12H,3-5H2,1-2H3/t6-,7-,8-,9?,10+/m1/s1 |
| InChIKey | QWRKUHXJOVZCMT-XJLOYYFOSA-N |
| XLogP | -0.15 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |