C8H14O2 — CID 45085675
1-[(2S,5R)-5-methyloxolan-2-yl]propan-2-one (PubChem CID 45085675) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-[(2S,5R)-5-methyloxolan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,5R)-5-methyloxolan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 45085675 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 1-[(2S,5R)-5-methyloxolan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1CC[C@@H](C)O1 |
| InChI | InChI=1S/C8H14O2/c1-6(9)5-8-4-3-7(2)10-8/h7-8H,3-5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | LFLJIWZCYFSSHZ-SFYZADRCSA-N |
| XLogP | 1.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |