C22H26O8 — CID 138659458
methyl 2-[(1S,2S,7S,9R,11S,13S)-10-oxo-11-(2-phenylmethoxyethyl)-3,8,12,14-tetraoxatetracyclo[9.2.1.02,7.09,13]tetradecan-4-yl]acetate (PubChem CID 138659458) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is methyl 2-[(1S,2S,7S,9R,11S,13S)-10-oxo-11-(2-phenylmethoxyethyl)-3,8,12,14-tetraoxatetracyclo[9.2.1.02,7.09,13]tetradecan-4-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,7S,9R,11S,13S)-10-oxo-11-(2-phenylmethoxyethyl)-3,8,12,14-tetraoxatetracyclo[9.2.1.02,7.09,13]tetradecan-4-yl]acetate |
|---|---|
| PubChem CID | 138659458 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl 2-[(1S,2S,7S,9R,11S,13S)-10-oxo-11-(2-phenylmethoxyethyl)-3,8,12,14-tetraoxatetracyclo[9.2.1.02,7.09,13]tetradecan-4-yl]acetate |
| SMILES | COC(=O)CC1CC[C@@H]2O[C@H]3C(=O)C4(CCOCc5ccccc5)O[C@@H]([C@H]2O1)[C@@H]3O4 |
| InChI | InChI=1S/C22H26O8/c1-25-16(23)11-14-7-8-15-17(27-14)18-19-20(28-15)21(24)22(29-18,30-19)9-10-26-12-13-5-3-2-4-6-13/h2-6,14-15,17-20H,7-12H2,1H3/t14?,15-,17-,18-,19-,20+,22?/m0/s1 |
| InChIKey | IZIXWLSZUWGVAH-NSOUVESTSA-N |
| XLogP | 1.53 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|