C25H42O8 — CID 145181491
ethane;methyl 2-[(5R)-4,8-dihydroxy-5-methyl-5-(7-methyl-2-oxooct-7-enyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate (PubChem CID 145181491) has the molecular formula C25H42O8 and a molecular weight of 470.60 g/mol. Its IUPAC name is ethane;methyl 2-[(5R)-4,8-dihydroxy-5-methyl-5-(7-methyl-2-oxooct-7-enyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate.
| Compound Name | ethane;methyl 2-[(5R)-4,8-dihydroxy-5-methyl-5-(7-methyl-2-oxooct-7-enyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
|---|---|
| PubChem CID | 145181491 |
| Molecular Formula | C25H42O8 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | ethane;methyl 2-[(5R)-4,8-dihydroxy-5-methyl-5-(7-methyl-2-oxooct-7-enyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
| SMILES | C=C(C)CCCCC(=O)C[C@@]1(C)OC2C(O)C3OC(CC(=O)OC)CCC3OC2C1O.CC |
| InChI | InChI=1S/C23H36O8.C2H6/c1-13(2)7-5-6-8-14(24)12-23(3)22(27)21-20(31-23)18(26)19-16(30-21)10-9-15(29-19)11-17(25)28-4;1-2/h15-16,18-22,26-27H,1,5-12H2,2-4H3;1-2H3/t15?,16?,18?,19?,20?,21?,22?,23-;/m1./s1 |
| InChIKey | GSDISMQFMDFLNF-LUQTUBEXSA-N |
| XLogP | 2.87 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|