C33H66O8Si3 — CID 10818255
methyl 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetate (PubChem CID 10818255) has the molecular formula C33H66O8Si3 and a molecular weight of 675.14 g/mol. Its IUPAC name is methyl 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetate.
| Compound Name | methyl 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetate |
|---|---|
| PubChem CID | 10818255 |
| Molecular Formula | C33H66O8Si3 |
| Molecular Weight | 675.14 g/mol |
| Exact Mass | 674.41 |
| IUPAC Name | methyl 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2O[C@H](CC(=O)OC)[C@H](O[Si](CC)(CC)CC)[C@@H]2O[C@H]2CC[C@H](CCO[Si](C)(C)C(C)(C)C)O[C@H]12 |
| InChI | InChI=1S/C33H66O8Si3/c1-13-43(14-2,15-3)40-29-26(23-27(34)35-10)39-31-30(29)38-25-20-19-24(21-22-36-42(11,12)33(7,8)9)37-28(25)32(31)41-44(16-4,17-5)18-6/h24-26,28-32H,13-23H2,1-12H3/t24-,25+,26-,28+,29+,30+,31-,32+/m1/s1 |
| InChIKey | MALJCKCMVZFUQI-IKCVFFNYSA-N |
| XLogP | 7.82 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.14 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|