C31H62O8Si3 — CID 11498334
methyl 2-[(2R,3R,4S,4aS,6R,8aS)-2-[(1R)-2-oxo-1-triethylsilyloxyethyl]-3,4-bis(triethylsilyloxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 11498334) has the molecular formula C31H62O8Si3 and a molecular weight of 647.09 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S,4aS,6R,8aS)-2-[(1R)-2-oxo-1-triethylsilyloxyethyl]-3,4-bis(triethylsilyloxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S,4aS,6R,8aS)-2-[(1R)-2-oxo-1-triethylsilyloxyethyl]-3,4-bis(triethylsilyloxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 11498334 |
| Molecular Formula | C31H62O8Si3 |
| Molecular Weight | 647.09 g/mol |
| Exact Mass | 646.38 |
| IUPAC Name | methyl 2-[(2R,3R,4S,4aS,6R,8aS)-2-[(1R)-2-oxo-1-triethylsilyloxyethyl]-3,4-bis(triethylsilyloxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](O[Si](CC)(CC)CC)[C@H]([C@H](C=O)O[Si](CC)(CC)CC)O[C@H]2CC[C@H](CC(=O)OC)O[C@H]12 |
| InChI | InChI=1S/C31H62O8Si3/c1-11-40(12-2,13-3)37-26(23-32)29-31(39-42(17-7,18-8)19-9)30(38-41(14-4,15-5)16-6)28-25(36-29)21-20-24(35-28)22-27(33)34-10/h23-26,28-31H,11-22H2,1-10H3/t24-,25+,26+,28+,29+,30+,31-/m1/s1 |
| InChIKey | KXSXKCLZEYSCTJ-KAXMYOQUSA-N |
| XLogP | 7.23 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.09 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|