C32H66O8Si3 — CID 12039189
ethyl (2R,3S,4S,5R,6R)-6-(2,2-dimethylpropanoyloxymethyl)-3,4,5-tris(triethylsilyloxy)oxane-2-carboxylate (PubChem CID 12039189) has the molecular formula C32H66O8Si3 and a molecular weight of 663.13 g/mol. Its IUPAC name is ethyl (2R,3S,4S,5R,6R)-6-(2,2-dimethylpropanoyloxymethyl)-3,4,5-tris(triethylsilyloxy)oxane-2-carboxylate.
| Compound Name | ethyl (2R,3S,4S,5R,6R)-6-(2,2-dimethylpropanoyloxymethyl)-3,4,5-tris(triethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 12039189 |
| Molecular Formula | C32H66O8Si3 |
| Molecular Weight | 663.13 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | ethyl (2R,3S,4S,5R,6R)-6-(2,2-dimethylpropanoyloxymethyl)-3,4,5-tris(triethylsilyloxy)oxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](O[Si](CC)(CC)CC)[C@H](O[Si](CC)(CC)CC)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H66O8Si3/c1-14-35-30(33)29-28(40-43(21-8,22-9)23-10)27(39-42(18-5,19-6)20-7)26(38-41(15-2,16-3)17-4)25(37-29)24-36-31(34)32(11,12)13/h25-29H,14-24H2,1-13H3/t25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | TYTWNIDAAIGCNF-XYPQWYOHSA-N |
| XLogP | 8.08 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.13 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|