C36H80O7Si5 — CID 553781
[tert-butyl(dimethyl)silyl] 3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]oxane-2-carboxylate (PubChem CID 553781) has the molecular formula C36H80O7Si5 and a molecular weight of 765.46 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]oxane-2-carboxylate.
| Compound Name | [tert-butyl(dimethyl)silyl] 3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 553781 |
| Molecular Formula | C36H80O7Si5 |
| Molecular Weight | 765.46 g/mol |
| Exact Mass | 764.48 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]oxane-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C1OC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H80O7Si5/c1-32(2,3)44(16,17)39-26-27(40-45(18,19)33(4,5)6)29(41-46(20,21)34(7,8)9)31(43-48(24,25)36(13,14)15)38-28(26)30(37)42-47(22,23)35(10,11)12/h26-29,31H,1-25H3 |
| InChIKey | CPLPYBCSNYKKAI-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.46 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|