C32H64O7Si3 — CID 15529035
1-[(4S,5R)-2,2-ditert-butyl-5-triethylsilyloxy-1,3,2-dioxasilinan-4-yl]-4-[(2R,3S)-3-triethylsilyloxyoxan-2-yl]butane-2,3-dione (PubChem CID 15529035) has the molecular formula C32H64O7Si3 and a molecular weight of 645.12 g/mol. Its IUPAC name is 1-[(4S,5R)-2,2-ditert-butyl-5-triethylsilyloxy-1,3,2-dioxasilinan-4-yl]-4-[(2R,3S)-3-triethylsilyloxyoxan-2-yl]butane-2,3-dione.
| Compound Name | 1-[(4S,5R)-2,2-ditert-butyl-5-triethylsilyloxy-1,3,2-dioxasilinan-4-yl]-4-[(2R,3S)-3-triethylsilyloxyoxan-2-yl]butane-2,3-dione |
|---|---|
| PubChem CID | 15529035 |
| Molecular Formula | C32H64O7Si3 |
| Molecular Weight | 645.12 g/mol |
| Exact Mass | 644.40 |
| IUPAC Name | 1-[(4S,5R)-2,2-ditert-butyl-5-triethylsilyloxy-1,3,2-dioxasilinan-4-yl]-4-[(2R,3S)-3-triethylsilyloxyoxan-2-yl]butane-2,3-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCCO[C@@H]1CC(=O)C(=O)C[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H64O7Si3/c1-13-40(14-2,15-3)37-27-20-19-21-35-28(27)22-25(33)26(34)23-29-30(38-41(16-4,17-5)18-6)24-36-42(39-29,31(7,8)9)32(10,11)12/h27-30H,13-24H2,1-12H3/t27-,28+,29-,30+/m0/s1 |
| InChIKey | CKSJAUILEAUNMR-RRGQHJHPSA-N |
| XLogP | 8.32 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.12 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|