C23H42O7Si — CID 10551862
(3aR,6R,6aR)-6-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 10551862) has the molecular formula C23H42O7Si and a molecular weight of 458.67 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6R,6aR)-6-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 10551862 |
| Molecular Formula | C23H42O7Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (3aR,6R,6aR)-6-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CCC1(CC)OC[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(=O)[C@@H]3OC(CC)(CC)O[C@H]23)O1 |
| InChI | InChI=1S/C23H42O7Si/c1-10-22(11-2)25-14-15(27-22)16(30-31(8,9)21(5,6)7)17-18-19(20(24)26-17)29-23(12-3,13-4)28-18/h15-19H,10-14H2,1-9H3/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | BIIMRDPAQCQHPK-UJWQCDCRSA-N |
| XLogP | 4.53 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|