C16H30O6Si — CID 101161100
methyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxobutanoate (PubChem CID 101161100) has the molecular formula C16H30O6Si and a molecular weight of 346.50 g/mol. Its IUPAC name is methyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxobutanoate.
| Compound Name | methyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxobutanoate |
|---|---|
| PubChem CID | 101161100 |
| Molecular Formula | C16H30O6Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | methyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxobutanoate |
| SMILES | COC(=O)C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H30O6Si/c1-15(2,3)23(7,8)22-12(9-11(17)14(18)19-6)13-10-20-16(4,5)21-13/h12-13H,9-10H2,1-8H3/t12-,13+/m0/s1 |
| InChIKey | KFNFHFMBPLUWSC-QWHCGFSZSA-N |
| XLogP | 2.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|