C19H34O7Si — CID 139067157
(5R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3,7-trioxaspiro[4.4]nonan-6-one (PubChem CID 139067157) has the molecular formula C19H34O7Si and a molecular weight of 402.56 g/mol. Its IUPAC name is (5R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3,7-trioxaspiro[4.4]nonan-6-one.
| Compound Name | (5R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3,7-trioxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 139067157 |
| Molecular Formula | C19H34O7Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (5R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3,7-trioxaspiro[4.4]nonan-6-one |
| SMILES | CC1(C)OC[C@H]([C@H]2OC(=O)[C@@]3(COC(C)(C)O3)[C@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H34O7Si/c1-16(2,3)27(8,9)25-14-13(12-10-21-17(4,5)24-12)23-15(20)19(14)11-22-18(6,7)26-19/h12-14H,10-11H2,1-9H3/t12-,13-,14+,19-/m1/s1 |
| InChIKey | VCQWYDNXGAEWHM-VYGYDYRJSA-N |
| XLogP | 2.98 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|