C15H26O6Si — CID 91247006
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(3-trimethylsilylpropoxy)oxolane-2,3-dione (PubChem CID 91247006) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(3-trimethylsilylpropoxy)oxolane-2,3-dione.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(3-trimethylsilylpropoxy)oxolane-2,3-dione |
|---|---|
| PubChem CID | 91247006 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(3-trimethylsilylpropoxy)oxolane-2,3-dione |
| SMILES | CC1(C)OCC(C2OC(=O)C(=O)C2OCCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C15H26O6Si/c1-15(2)19-9-10(21-15)12-13(11(16)14(17)20-12)18-7-6-8-22(3,4)5/h10,12-13H,6-9H2,1-5H3 |
| InChIKey | YRKAWXPBSCNTPW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|