C19H38O5Si2 — CID 135023102
(5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,7-dioxaspiro[4.4]nonan-8-one (PubChem CID 135023102) has the molecular formula C19H38O5Si2 and a molecular weight of 402.68 g/mol. Its IUPAC name is (5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,7-dioxaspiro[4.4]nonan-8-one.
| Compound Name | (5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,7-dioxaspiro[4.4]nonan-8-one |
|---|---|
| PubChem CID | 135023102 |
| Molecular Formula | C19H38O5Si2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,7-dioxaspiro[4.4]nonan-8-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CO[C@]2(COC(=O)C2)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O5Si2/c1-17(2,3)25(7,8)23-14-12-22-19(11-15(20)21-13-19)16(14)24-26(9,10)18(4,5)6/h14,16H,11-13H2,1-10H3/t14?,16?,19-/m1/s1 |
| InChIKey | JQIQGNZMDVEFTA-GSQSYGFSSA-N |
| XLogP | 4.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|