C19H38O5Si2 — CID 10525184
(2S,3R,3aS,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 10525184) has the molecular formula C19H38O5Si2 and a molecular weight of 402.68 g/mol. Its IUPAC name is (2S,3R,3aS,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2S,3R,3aS,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 10525184 |
| Molecular Formula | C19H38O5Si2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (2S,3R,3aS,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H]2CC(=O)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O5Si2/c1-18(2,3)25(7,8)21-12-14-17(24-26(9,10)19(4,5)6)16-13(22-14)11-15(20)23-16/h13-14,16-17H,11-12H2,1-10H3/t13-,14+,16+,17-/m1/s1 |
| InChIKey | QYSCILXCFSJVQF-YQFWSFKMSA-N |
| XLogP | 4.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|